C18H23N3O2 — CID 109228089
5-(3,4-dimethylanilino)-N-(3-methoxypropyl)pyridine-3-carboxamide (PubChem CID 109228089) has the molecular formula C18H23N3O2 and a molecular weight of 313.40 g/mol. Its IUPAC name is 5-(3,4-dimethylanilino)-N-(3-methoxypropyl)pyridine-3-carboxamide.
| Compound Name | 5-(3,4-dimethylanilino)-N-(3-methoxypropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109228089 |
| Molecular Formula | C18H23N3O2 |
| Molecular Weight | 313.40 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 5-(3,4-dimethylanilino)-N-(3-methoxypropyl)pyridine-3-carboxamide |
| SMILES | COCCCNC(=O)c1cncc(Nc2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C18H23N3O2/c1-13-5-6-16(9-14(13)2)21-17-10-15(11-19-12-17)18(22)20-7-4-8-23-3/h5-6,9-12,21H,4,7-8H2,1-3H3,(H,20,22) |
| InChIKey | RHZOXVYXJIYZTA-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.40 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|