C16H17F2N3O2 — CID 109228185
5-(3,4-difluoroanilino)-N-(3-methoxypropyl)pyridine-3-carboxamide (PubChem CID 109228185) has the molecular formula C16H17F2N3O2 and a molecular weight of 321.33 g/mol. Its IUPAC name is 5-(3,4-difluoroanilino)-N-(3-methoxypropyl)pyridine-3-carboxamide.
| Compound Name | 5-(3,4-difluoroanilino)-N-(3-methoxypropyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109228185 |
| Molecular Formula | C16H17F2N3O2 |
| Molecular Weight | 321.33 g/mol |
| Exact Mass | 321.13 |
| IUPAC Name | 5-(3,4-difluoroanilino)-N-(3-methoxypropyl)pyridine-3-carboxamide |
| SMILES | COCCCNC(=O)c1cncc(Nc2ccc(F)c(F)c2)c1 |
| InChI | InChI=1S/C16H17F2N3O2/c1-23-6-2-5-20-16(22)11-7-13(10-19-9-11)21-12-3-4-14(17)15(18)8-12/h3-4,7-10,21H,2,5-6H2,1H3,(H,20,22) |
| InChIKey | JTJPKIKUNPVYGZ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.33 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|