C17H18F3N3O2 — CID 109228132
N-(3-methoxypropyl)-5-[4-(trifluoromethyl)anilino]pyridine-3-carboxamide (PubChem CID 109228132) has the molecular formula C17H18F3N3O2 and a molecular weight of 353.34 g/mol. Its IUPAC name is N-(3-methoxypropyl)-5-[4-(trifluoromethyl)anilino]pyridine-3-carboxamide.
| Compound Name | N-(3-methoxypropyl)-5-[4-(trifluoromethyl)anilino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109228132 |
| Molecular Formula | C17H18F3N3O2 |
| Molecular Weight | 353.34 g/mol |
| Exact Mass | 353.14 |
| IUPAC Name | N-(3-methoxypropyl)-5-[4-(trifluoromethyl)anilino]pyridine-3-carboxamide |
| SMILES | COCCCNC(=O)c1cncc(Nc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C17H18F3N3O2/c1-25-8-2-7-22-16(24)12-9-15(11-21-10-12)23-14-5-3-13(4-6-14)17(18,19)20/h3-6,9-11,23H,2,7-8H2,1H3,(H,22,24) |
| InChIKey | FQPOEDRSXKXRLD-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 63.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.34 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|