C18H18F3N3O3 — CID 109103680
3-N-(3-methoxypropyl)-5-N-[4-(trifluoromethyl)phenyl]pyridine-3,5-dicarboxamide (PubChem CID 109103680) has the molecular formula C18H18F3N3O3 and a molecular weight of 381.35 g/mol. Its IUPAC name is 3-N-(3-methoxypropyl)-5-N-[4-(trifluoromethyl)phenyl]pyridine-3,5-dicarboxamide.
| Compound Name | 3-N-(3-methoxypropyl)-5-N-[4-(trifluoromethyl)phenyl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109103680 |
| Molecular Formula | C18H18F3N3O3 |
| Molecular Weight | 381.35 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 3-N-(3-methoxypropyl)-5-N-[4-(trifluoromethyl)phenyl]pyridine-3,5-dicarboxamide |
| SMILES | COCCCNC(=O)c1cncc(C(=O)Nc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C18H18F3N3O3/c1-27-8-2-7-23-16(25)12-9-13(11-22-10-12)17(26)24-15-5-3-14(4-6-15)18(19,20)21/h3-6,9-11H,2,7-8H2,1H3,(H,23,25)(H,24,26) |
| InChIKey | WPOVXRAVEONHFO-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.35 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|