C21H16F3N3O2 — CID 109105061
3-N-benzyl-5-N-[4-(trifluoromethyl)phenyl]pyridine-3,5-dicarboxamide (PubChem CID 109105061) has the molecular formula C21H16F3N3O2 and a molecular weight of 399.37 g/mol. Its IUPAC name is 3-N-benzyl-5-N-[4-(trifluoromethyl)phenyl]pyridine-3,5-dicarboxamide.
| Compound Name | 3-N-benzyl-5-N-[4-(trifluoromethyl)phenyl]pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109105061 |
| Molecular Formula | C21H16F3N3O2 |
| Molecular Weight | 399.37 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | 3-N-benzyl-5-N-[4-(trifluoromethyl)phenyl]pyridine-3,5-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)c1cncc(C(=O)Nc2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C21H16F3N3O2/c22-21(23,24)17-6-8-18(9-7-17)27-20(29)16-10-15(12-25-13-16)19(28)26-11-14-4-2-1-3-5-14/h1-10,12-13H,11H2,(H,26,28)(H,27,29) |
| InChIKey | KFEOIZRNAAIXFN-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.37 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |