C20H14F3N3O2 — CID 109105080
3-N-benzyl-5-N-(2,3,4-trifluorophenyl)pyridine-3,5-dicarboxamide (PubChem CID 109105080) has the molecular formula C20H14F3N3O2 and a molecular weight of 385.35 g/mol. Its IUPAC name is 3-N-benzyl-5-N-(2,3,4-trifluorophenyl)pyridine-3,5-dicarboxamide.
| Compound Name | 3-N-benzyl-5-N-(2,3,4-trifluorophenyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109105080 |
| Molecular Formula | C20H14F3N3O2 |
| Molecular Weight | 385.35 g/mol |
| Exact Mass | 385.10 |
| IUPAC Name | 3-N-benzyl-5-N-(2,3,4-trifluorophenyl)pyridine-3,5-dicarboxamide |
| SMILES | O=C(NCc1ccccc1)c1cncc(C(=O)Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C20H14F3N3O2/c21-15-6-7-16(18(23)17(15)22)26-20(28)14-8-13(10-24-11-14)19(27)25-9-12-4-2-1-3-5-12/h1-8,10-11H,9H2,(H,25,27)(H,26,28) |
| InChIKey | XOZAUFLHZIALMH-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.35 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|