C16H14F3N3O2 — CID 109101322
3-N-propyl-5-N-(2,3,4-trifluorophenyl)pyridine-3,5-dicarboxamide (PubChem CID 109101322) has the molecular formula C16H14F3N3O2 and a molecular weight of 337.30 g/mol. Its IUPAC name is 3-N-propyl-5-N-(2,3,4-trifluorophenyl)pyridine-3,5-dicarboxamide.
| Compound Name | 3-N-propyl-5-N-(2,3,4-trifluorophenyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109101322 |
| Molecular Formula | C16H14F3N3O2 |
| Molecular Weight | 337.30 g/mol |
| Exact Mass | 337.10 |
| IUPAC Name | 3-N-propyl-5-N-(2,3,4-trifluorophenyl)pyridine-3,5-dicarboxamide |
| SMILES | CCCNC(=O)c1cncc(C(=O)Nc2ccc(F)c(F)c2F)c1 |
| InChI | InChI=1S/C16H14F3N3O2/c1-2-5-21-15(23)9-6-10(8-20-7-9)16(24)22-12-4-3-11(17)13(18)14(12)19/h3-4,6-8H,2,5H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | FMXOCHCPCINMGH-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.30 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|