C23H23N3O2 — CID 109105028
3-N-benzyl-5-N-(2-propan-2-ylphenyl)pyridine-3,5-dicarboxamide (PubChem CID 109105028) has the molecular formula C23H23N3O2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 3-N-benzyl-5-N-(2-propan-2-ylphenyl)pyridine-3,5-dicarboxamide.
| Compound Name | 3-N-benzyl-5-N-(2-propan-2-ylphenyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109105028 |
| Molecular Formula | C23H23N3O2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.18 |
| IUPAC Name | 3-N-benzyl-5-N-(2-propan-2-ylphenyl)pyridine-3,5-dicarboxamide |
| SMILES | CC(C)c1ccccc1NC(=O)c1cncc(C(=O)NCc2ccccc2)c1 |
| InChI | InChI=1S/C23H23N3O2/c1-16(2)20-10-6-7-11-21(20)26-23(28)19-12-18(14-24-15-19)22(27)25-13-17-8-4-3-5-9-17/h3-12,14-16H,13H2,1-2H3,(H,25,27)(H,26,28) |
| InChIKey | FRYKLEBBEHQGNP-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |