C22H22ClN3O — CID 109234113
5-[(4-chlorophenyl)methylamino]-N-(2-propan-2-ylphenyl)pyridine-3-carboxamide (PubChem CID 109234113) has the molecular formula C22H22ClN3O and a molecular weight of 379.89 g/mol. Its IUPAC name is 5-[(4-chlorophenyl)methylamino]-N-(2-propan-2-ylphenyl)pyridine-3-carboxamide.
| Compound Name | 5-[(4-chlorophenyl)methylamino]-N-(2-propan-2-ylphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109234113 |
| Molecular Formula | C22H22ClN3O |
| Molecular Weight | 379.89 g/mol |
| Exact Mass | 379.15 |
| IUPAC Name | 5-[(4-chlorophenyl)methylamino]-N-(2-propan-2-ylphenyl)pyridine-3-carboxamide |
| SMILES | CC(C)c1ccccc1NC(=O)c1cncc(NCc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C22H22ClN3O/c1-15(2)20-5-3-4-6-21(20)26-22(27)17-11-19(14-24-13-17)25-12-16-7-9-18(23)10-8-16/h3-11,13-15,25H,12H2,1-2H3,(H,26,27) |
| InChIKey | LJYRFJNEGLTCHE-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.89 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |