C17H27N3O3 — CID 109103626
3-N-(3-methoxypropyl)-5-N,5-N-dipropylpyridine-3,5-dicarboxamide (PubChem CID 109103626) has the molecular formula C17H27N3O3 and a molecular weight of 321.42 g/mol. Its IUPAC name is 3-N-(3-methoxypropyl)-5-N,5-N-dipropylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-(3-methoxypropyl)-5-N,5-N-dipropylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109103626 |
| Molecular Formula | C17H27N3O3 |
| Molecular Weight | 321.42 g/mol |
| Exact Mass | 321.21 |
| IUPAC Name | 3-N-(3-methoxypropyl)-5-N,5-N-dipropylpyridine-3,5-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cncc(C(=O)NCCCOC)c1 |
| InChI | InChI=1S/C17H27N3O3/c1-4-8-20(9-5-2)17(22)15-11-14(12-18-13-15)16(21)19-7-6-10-23-3/h11-13H,4-10H2,1-3H3,(H,19,21) |
| InChIKey | SZMHSWRAFLMEQH-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.42 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|