C21H26FN3O2 — CID 109106315
3-N-[2-(2-fluorophenyl)ethyl]-5-N,5-N-dipropylpyridine-3,5-dicarboxamide (PubChem CID 109106315) has the molecular formula C21H26FN3O2 and a molecular weight of 371.46 g/mol. Its IUPAC name is 3-N-[2-(2-fluorophenyl)ethyl]-5-N,5-N-dipropylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-[2-(2-fluorophenyl)ethyl]-5-N,5-N-dipropylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109106315 |
| Molecular Formula | C21H26FN3O2 |
| Molecular Weight | 371.46 g/mol |
| Exact Mass | 371.20 |
| IUPAC Name | 3-N-[2-(2-fluorophenyl)ethyl]-5-N,5-N-dipropylpyridine-3,5-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cncc(C(=O)NCCc2ccccc2F)c1 |
| InChI | InChI=1S/C21H26FN3O2/c1-3-11-25(12-4-2)21(27)18-13-17(14-23-15-18)20(26)24-10-9-16-7-5-6-8-19(16)22/h5-8,13-15H,3-4,9-12H2,1-2H3,(H,24,26) |
| InChIKey | FXTDCBGGYHLMCD-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.46 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |