C18H29N3O2 — CID 109107218
3-N-pentyl-5-N,5-N-dipropylpyridine-3,5-dicarboxamide (PubChem CID 109107218) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is 3-N-pentyl-5-N,5-N-dipropylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-pentyl-5-N,5-N-dipropylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109107218 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | 3-N-pentyl-5-N,5-N-dipropylpyridine-3,5-dicarboxamide |
| SMILES | CCCCCNC(=O)c1cncc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C18H29N3O2/c1-4-7-8-9-20-17(22)15-12-16(14-19-13-15)18(23)21(10-5-2)11-6-3/h12-14H,4-11H2,1-3H3,(H,20,22) |
| InChIKey | ITDBVQQSSWUINA-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|