C16H27N3O — CID 109224616
5-(butylamino)-N,N-dipropylpyridine-3-carboxamide (PubChem CID 109224616) has the molecular formula C16H27N3O and a molecular weight of 277.41 g/mol. Its IUPAC name is 5-(butylamino)-N,N-dipropylpyridine-3-carboxamide.
| Compound Name | 5-(butylamino)-N,N-dipropylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109224616 |
| Molecular Formula | C16H27N3O |
| Molecular Weight | 277.41 g/mol |
| Exact Mass | 277.22 |
| IUPAC Name | 5-(butylamino)-N,N-dipropylpyridine-3-carboxamide |
| SMILES | CCCCNc1cncc(C(=O)N(CCC)CCC)c1 |
| InChI | InChI=1S/C16H27N3O/c1-4-7-8-18-15-11-14(12-17-13-15)16(20)19(9-5-2)10-6-3/h11-13,18H,4-10H2,1-3H3 |
| InChIKey | DFGSYHAKXAJJNA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|