C14H23N3O — CID 109238760
5-(tert-butylamino)-N,N-diethylpyridine-3-carboxamide (PubChem CID 109238760) has the molecular formula C14H23N3O and a molecular weight of 249.36 g/mol. Its IUPAC name is 5-(tert-butylamino)-N,N-diethylpyridine-3-carboxamide.
| Compound Name | 5-(tert-butylamino)-N,N-diethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109238760 |
| Molecular Formula | C14H23N3O |
| Molecular Weight | 249.36 g/mol |
| Exact Mass | 249.18 |
| IUPAC Name | 5-(tert-butylamino)-N,N-diethylpyridine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cncc(NC(C)(C)C)c1 |
| InChI | InChI=1S/C14H23N3O/c1-6-17(7-2)13(18)11-8-12(10-15-9-11)16-14(3,4)5/h8-10,16H,6-7H2,1-5H3 |
| InChIKey | YMVOTMKOWJYJLO-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |