C19H21N3O3 — CID 109106794
3-N-(3-acetylphenyl)-5-N,5-N-diethylpyridine-3,5-dicarboxamide (PubChem CID 109106794) has the molecular formula C19H21N3O3 and a molecular weight of 339.40 g/mol. Its IUPAC name is 3-N-(3-acetylphenyl)-5-N,5-N-diethylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-(3-acetylphenyl)-5-N,5-N-diethylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109106794 |
| Molecular Formula | C19H21N3O3 |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.16 |
| IUPAC Name | 3-N-(3-acetylphenyl)-5-N,5-N-diethylpyridine-3,5-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1cncc(C(=O)Nc2cccc(C(C)=O)c2)c1 |
| InChI | InChI=1S/C19H21N3O3/c1-4-22(5-2)19(25)16-9-15(11-20-12-16)18(24)21-17-8-6-7-14(10-17)13(3)23/h6-12H,4-5H2,1-3H3,(H,21,24) |
| InChIKey | NDJWMAVIUTVARD-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 79.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |