C17H18ClN3O2 — CID 109106769
3-N-(4-chlorophenyl)-5-N,5-N-diethylpyridine-3,5-dicarboxamide (PubChem CID 109106769) has the molecular formula C17H18ClN3O2 and a molecular weight of 331.80 g/mol. Its IUPAC name is 3-N-(4-chlorophenyl)-5-N,5-N-diethylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-(4-chlorophenyl)-5-N,5-N-diethylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109106769 |
| Molecular Formula | C17H18ClN3O2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 331.11 |
| IUPAC Name | 3-N-(4-chlorophenyl)-5-N,5-N-diethylpyridine-3,5-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1cncc(C(=O)Nc2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C17H18ClN3O2/c1-3-21(4-2)17(23)13-9-12(10-19-11-13)16(22)20-15-7-5-14(18)6-8-15/h5-11H,3-4H2,1-2H3,(H,20,22) |
| InChIKey | FLOHZLIEUKURTL-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |