C18H23N3O — CID 109238786
5-(2,3-dimethylanilino)-N,N-diethylpyridine-3-carboxamide (PubChem CID 109238786) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 5-(2,3-dimethylanilino)-N,N-diethylpyridine-3-carboxamide.
| Compound Name | 5-(2,3-dimethylanilino)-N,N-diethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109238786 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 5-(2,3-dimethylanilino)-N,N-diethylpyridine-3-carboxamide |
| SMILES | CCN(CC)C(=O)c1cncc(Nc2cccc(C)c2C)c1 |
| InChI | InChI=1S/C18H23N3O/c1-5-21(6-2)18(22)15-10-16(12-19-11-15)20-17-9-7-8-13(3)14(17)4/h7-12,20H,5-6H2,1-4H3 |
| InChIKey | KASRDJLOIXTLES-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |