C25H29N3O — CID 109234765
N-benzyl-5-(4-tert-butylanilino)-N-ethylpyridine-3-carboxamide (PubChem CID 109234765) has the molecular formula C25H29N3O and a molecular weight of 387.53 g/mol. Its IUPAC name is N-benzyl-5-(4-tert-butylanilino)-N-ethylpyridine-3-carboxamide.
| Compound Name | N-benzyl-5-(4-tert-butylanilino)-N-ethylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 109234765 |
| Molecular Formula | C25H29N3O |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 387.23 |
| IUPAC Name | N-benzyl-5-(4-tert-butylanilino)-N-ethylpyridine-3-carboxamide |
| SMILES | CCN(Cc1ccccc1)C(=O)c1cncc(Nc2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C25H29N3O/c1-5-28(18-19-9-7-6-8-10-19)24(29)20-15-23(17-26-16-20)27-22-13-11-21(12-14-22)25(2,3)4/h6-17,27H,5,18H2,1-4H3 |
| InChIKey | IUGVKAQGRHEKDN-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |