C18H23N3O3 — CID 109104880
3-N-(furan-2-ylmethyl)-5-N,5-N-dipropylpyridine-3,5-dicarboxamide (PubChem CID 109104880) has the molecular formula C18H23N3O3 and a molecular weight of 329.40 g/mol. Its IUPAC name is 3-N-(furan-2-ylmethyl)-5-N,5-N-dipropylpyridine-3,5-dicarboxamide.
| Compound Name | 3-N-(furan-2-ylmethyl)-5-N,5-N-dipropylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109104880 |
| Molecular Formula | C18H23N3O3 |
| Molecular Weight | 329.40 g/mol |
| Exact Mass | 329.17 |
| IUPAC Name | 3-N-(furan-2-ylmethyl)-5-N,5-N-dipropylpyridine-3,5-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cncc(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C18H23N3O3/c1-3-7-21(8-4-2)18(23)15-10-14(11-19-12-15)17(22)20-13-16-6-5-9-24-16/h5-6,9-12H,3-4,7-8,13H2,1-2H3,(H,20,22) |
| InChIKey | FRRCSQSZTORPLM-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.40 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |