C20H19N3O4 — CID 109104924
5-N-(4-ethoxyphenyl)-3-N-(furan-2-ylmethyl)pyridine-3,5-dicarboxamide (PubChem CID 109104924) has the molecular formula C20H19N3O4 and a molecular weight of 365.39 g/mol. Its IUPAC name is 5-N-(4-ethoxyphenyl)-3-N-(furan-2-ylmethyl)pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-(4-ethoxyphenyl)-3-N-(furan-2-ylmethyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109104924 |
| Molecular Formula | C20H19N3O4 |
| Molecular Weight | 365.39 g/mol |
| Exact Mass | 365.14 |
| IUPAC Name | 5-N-(4-ethoxyphenyl)-3-N-(furan-2-ylmethyl)pyridine-3,5-dicarboxamide |
| SMILES | CCOc1ccc(NC(=O)c2cncc(C(=O)NCc3ccco3)c2)cc1 |
| InChI | InChI=1S/C20H19N3O4/c1-2-26-17-7-5-16(6-8-17)23-20(25)15-10-14(11-21-12-15)19(24)22-13-18-4-3-9-27-18/h3-12H,2,13H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | KMLAMQUNZHHQHQ-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.39 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |