C20H21N3O3 — CID 109231569
5-(furan-2-ylmethylamino)-N-(4-propan-2-yloxyphenyl)pyridine-3-carboxamide (PubChem CID 109231569) has the molecular formula C20H21N3O3 and a molecular weight of 351.41 g/mol. Its IUPAC name is 5-(furan-2-ylmethylamino)-N-(4-propan-2-yloxyphenyl)pyridine-3-carboxamide.
| Compound Name | 5-(furan-2-ylmethylamino)-N-(4-propan-2-yloxyphenyl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 109231569 |
| Molecular Formula | C20H21N3O3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.16 |
| IUPAC Name | 5-(furan-2-ylmethylamino)-N-(4-propan-2-yloxyphenyl)pyridine-3-carboxamide |
| SMILES | CC(C)Oc1ccc(NC(=O)c2cncc(NCc3ccco3)c2)cc1 |
| InChI | InChI=1S/C20H21N3O3/c1-14(2)26-18-7-5-16(6-8-18)23-20(24)15-10-17(12-21-11-15)22-13-19-4-3-9-25-19/h3-12,14,22H,13H2,1-2H3,(H,23,24) |
| InChIKey | UVUKKEMNVVHKIA-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |