C19H17N3O4 — CID 109085096
4-N-(furan-2-ylmethyl)-2-N-(4-methoxyphenyl)pyridine-2,4-dicarboxamide (PubChem CID 109085096) has the molecular formula C19H17N3O4 and a molecular weight of 351.36 g/mol. Its IUPAC name is 4-N-(furan-2-ylmethyl)-2-N-(4-methoxyphenyl)pyridine-2,4-dicarboxamide.
| Compound Name | 4-N-(furan-2-ylmethyl)-2-N-(4-methoxyphenyl)pyridine-2,4-dicarboxamide |
|---|---|
| PubChem CID | 109085096 |
| Molecular Formula | C19H17N3O4 |
| Molecular Weight | 351.36 g/mol |
| Exact Mass | 351.12 |
| IUPAC Name | 4-N-(furan-2-ylmethyl)-2-N-(4-methoxyphenyl)pyridine-2,4-dicarboxamide |
| SMILES | COc1ccc(NC(=O)c2cc(C(=O)NCc3ccco3)ccn2)cc1 |
| InChI | InChI=1S/C19H17N3O4/c1-25-15-6-4-14(5-7-15)22-19(24)17-11-13(8-9-20-17)18(23)21-12-16-3-2-10-26-16/h2-11H,12H2,1H3,(H,21,23)(H,22,24) |
| InChIKey | LTNSSZNTGWMQTF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 93.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |