C17H19N3O3 — CID 109102679
5-N-cyclopentyl-3-N-(furan-2-ylmethyl)pyridine-3,5-dicarboxamide (PubChem CID 109102679) has the molecular formula C17H19N3O3 and a molecular weight of 313.36 g/mol. Its IUPAC name is 5-N-cyclopentyl-3-N-(furan-2-ylmethyl)pyridine-3,5-dicarboxamide.
| Compound Name | 5-N-cyclopentyl-3-N-(furan-2-ylmethyl)pyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109102679 |
| Molecular Formula | C17H19N3O3 |
| Molecular Weight | 313.36 g/mol |
| Exact Mass | 313.14 |
| IUPAC Name | 5-N-cyclopentyl-3-N-(furan-2-ylmethyl)pyridine-3,5-dicarboxamide |
| SMILES | O=C(NCc1ccco1)c1cncc(C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C17H19N3O3/c21-16(19-11-15-6-3-7-23-15)12-8-13(10-18-9-12)17(22)20-14-4-1-2-5-14/h3,6-10,14H,1-2,4-5,11H2,(H,19,21)(H,20,22) |
| InChIKey | TUUVLFZUYAXBBU-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 84.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.36 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |