C27H30N4O4 — CID 54831065
N-cyclohexyl-3-[[2-[3-(furan-2-ylmethylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide (PubChem CID 54831065) has the molecular formula C27H30N4O4 and a molecular weight of 474.56 g/mol. Its IUPAC name is N-cyclohexyl-3-[[2-[3-(furan-2-ylmethylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide.
| Compound Name | N-cyclohexyl-3-[[2-[3-(furan-2-ylmethylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide |
|---|---|
| PubChem CID | 54831065 |
| Molecular Formula | C27H30N4O4 |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.23 |
| IUPAC Name | N-cyclohexyl-3-[[2-[3-(furan-2-ylmethylcarbamoyl)anilino]-2-oxoethyl]amino]benzamide |
| SMILES | O=C(CNc1cccc(C(=O)NC2CCCCC2)c1)Nc1cccc(C(=O)NCc2ccco2)c1 |
| InChI | InChI=1S/C27H30N4O4/c32-25(30-23-12-5-7-19(16-23)26(33)29-17-24-13-6-14-35-24)18-28-22-11-4-8-20(15-22)27(34)31-21-9-2-1-3-10-21/h4-8,11-16,21,28H,1-3,9-10,17-18H2,(H,29,33)(H,30,32)(H,31,34) |
| InChIKey | ZSWCYWKPJVFSPQ-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 112.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |