C25H26N4O4 — CID 54834609
N-(furan-2-ylmethyl)-3-[[2-oxo-2-[3-(pyrrolidine-1-carbonyl)anilino]ethyl]amino]benzamide (PubChem CID 54834609) has the molecular formula C25H26N4O4 and a molecular weight of 446.51 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-3-[[2-oxo-2-[3-(pyrrolidine-1-carbonyl)anilino]ethyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-3-[[2-oxo-2-[3-(pyrrolidine-1-carbonyl)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54834609 |
| Molecular Formula | C25H26N4O4 |
| Molecular Weight | 446.51 g/mol |
| Exact Mass | 446.20 |
| IUPAC Name | N-(furan-2-ylmethyl)-3-[[2-oxo-2-[3-(pyrrolidine-1-carbonyl)anilino]ethyl]amino]benzamide |
| SMILES | O=C(CNc1cccc(C(=O)NCc2ccco2)c1)Nc1cccc(C(=O)N2CCCC2)c1 |
| InChI | InChI=1S/C25H26N4O4/c30-23(28-21-9-4-7-19(15-21)25(32)29-11-1-2-12-29)17-26-20-8-3-6-18(14-20)24(31)27-16-22-10-5-13-33-22/h3-10,13-15,26H,1-2,11-12,16-17H2,(H,27,31)(H,28,30) |
| InChIKey | YTNJMYXEABNUIB-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.51 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |