C26H28N4O4 — CID 54843208
N-(furan-2-ylmethyl)-4-[[2-oxo-2-[4-(piperidine-1-carbonyl)anilino]ethyl]amino]benzamide (PubChem CID 54843208) has the molecular formula C26H28N4O4 and a molecular weight of 460.53 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-[[2-oxo-2-[4-(piperidine-1-carbonyl)anilino]ethyl]amino]benzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-[[2-oxo-2-[4-(piperidine-1-carbonyl)anilino]ethyl]amino]benzamide |
|---|---|
| PubChem CID | 54843208 |
| Molecular Formula | C26H28N4O4 |
| Molecular Weight | 460.53 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-[[2-oxo-2-[4-(piperidine-1-carbonyl)anilino]ethyl]amino]benzamide |
| SMILES | O=C(CNc1ccc(C(=O)NCc2ccco2)cc1)Nc1ccc(C(=O)N2CCCCC2)cc1 |
| InChI | InChI=1S/C26H28N4O4/c31-24(29-22-12-8-20(9-13-22)26(33)30-14-2-1-3-15-30)18-27-21-10-6-19(7-11-21)25(32)28-17-23-5-4-16-34-23/h4-13,16,27H,1-3,14-15,17-18H2,(H,28,32)(H,29,31) |
| InChIKey | SGWWEOOXWIIRON-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 103.68 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.53 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |