C18H21N3O2S — CID 2954454
1-(furan-2-ylmethyl)-3-[4-(piperidine-1-carbonyl)phenyl]thiourea (PubChem CID 2954454) has the molecular formula C18H21N3O2S and a molecular weight of 343.45 g/mol. Its IUPAC name is 1-(furan-2-ylmethyl)-3-[4-(piperidine-1-carbonyl)phenyl]thiourea.
| Compound Name | 1-(furan-2-ylmethyl)-3-[4-(piperidine-1-carbonyl)phenyl]thiourea |
|---|---|
| PubChem CID | 2954454 |
| Molecular Formula | C18H21N3O2S |
| Molecular Weight | 343.45 g/mol |
| Exact Mass | 343.14 |
| IUPAC Name | 1-(furan-2-ylmethyl)-3-[4-(piperidine-1-carbonyl)phenyl]thiourea |
| SMILES | O=C(c1ccc(NC(=S)NCc2ccco2)cc1)N1CCCCC1 |
| InChI | InChI=1S/C18H21N3O2S/c22-17(21-10-2-1-3-11-21)14-6-8-15(9-7-14)20-18(24)19-13-16-5-4-12-23-16/h4-9,12H,1-3,10-11,13H2,(H2,19,20,24) |
| InChIKey | HKCHGIXSRUTEDU-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.45 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|