C18H27N3O2S — CID 43075806
1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-(furan-2-ylmethyl)thiourea (PubChem CID 43075806) has the molecular formula C18H27N3O2S and a molecular weight of 349.50 g/mol. Its IUPAC name is 1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-(furan-2-ylmethyl)thiourea.
| Compound Name | 1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-(furan-2-ylmethyl)thiourea |
|---|---|
| PubChem CID | 43075806 |
| Molecular Formula | C18H27N3O2S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.18 |
| IUPAC Name | 1-[1-(cyclohexanecarbonyl)piperidin-4-yl]-3-(furan-2-ylmethyl)thiourea |
| SMILES | O=C(C1CCCCC1)N1CCC(NC(=S)NCc2ccco2)CC1 |
| InChI | InChI=1S/C18H27N3O2S/c22-17(14-5-2-1-3-6-14)21-10-8-15(9-11-21)20-18(24)19-13-16-7-4-12-23-16/h4,7,12,14-15H,1-3,5-6,8-11,13H2,(H2,19,20,24) |
| InChIKey | RTALPMSNZGFJEN-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|