C17H25N3O2 — CID 109102730
5-N-cyclopentyl-3-N-pentylpyridine-3,5-dicarboxamide (PubChem CID 109102730) has the molecular formula C17H25N3O2 and a molecular weight of 303.41 g/mol. Its IUPAC name is 5-N-cyclopentyl-3-N-pentylpyridine-3,5-dicarboxamide.
| Compound Name | 5-N-cyclopentyl-3-N-pentylpyridine-3,5-dicarboxamide |
|---|---|
| PubChem CID | 109102730 |
| Molecular Formula | C17H25N3O2 |
| Molecular Weight | 303.41 g/mol |
| Exact Mass | 303.19 |
| IUPAC Name | 5-N-cyclopentyl-3-N-pentylpyridine-3,5-dicarboxamide |
| SMILES | CCCCCNC(=O)c1cncc(C(=O)NC2CCCC2)c1 |
| InChI | InChI=1S/C17H25N3O2/c1-2-3-6-9-19-16(21)13-10-14(12-18-11-13)17(22)20-15-7-4-5-8-15/h10-12,15H,2-9H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | LHFVXCTYTDMOKA-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.41 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|