C39H69N3O3 — CID 121284589
1-N,3-N,3-N-tris-decylbenzene-1,3,5-tricarboxamide (PubChem CID 121284589) has the molecular formula C39H69N3O3 and a molecular weight of 628.00 g/mol. Its IUPAC name is 1-N,3-N,3-N-tris-decylbenzene-1,3,5-tricarboxamide.
| Compound Name | 1-N,3-N,3-N-tris-decylbenzene-1,3,5-tricarboxamide |
|---|---|
| PubChem CID | 121284589 |
| Molecular Formula | C39H69N3O3 |
| Molecular Weight | 628.00 g/mol |
| Exact Mass | 627.53 |
| IUPAC Name | 1-N,3-N,3-N-tris-decylbenzene-1,3,5-tricarboxamide |
| SMILES | CCCCCCCCCCNC(=O)c1cc(C(N)=O)cc(C(=O)N(CCCCCCCCCC)CCCCCCCCCC)c1 |
| InChI | InChI=1S/C39H69N3O3/c1-4-7-10-13-16-19-22-25-28-41-38(44)35-31-34(37(40)43)32-36(33-35)39(45)42(29-26-23-20-17-14-11-8-5-2)30-27-24-21-18-15-12-9-6-3/h31-33H,4-30H2,1-3H3,(H2,40,43)(H,41,44) |
| InChIKey | URBYHUZBJZVHQA-UHFFFAOYSA-N |
| XLogP | 10.38 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 30 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.00 |
| LogP ≤ 5 | 10.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|