C28H31N3O12 — CID 118731888
3,4,5-trihydroxy-N-[4-[(3,4,5-trihydroxybenzoyl)-[3-[(3,4,5-trihydroxybenzoyl)amino]propyl]amino]butyl]benzamide (PubChem CID 118731888) has the molecular formula C28H31N3O12 and a molecular weight of 601.57 g/mol. Its IUPAC name is 3,4,5-trihydroxy-N-[4-[(3,4,5-trihydroxybenzoyl)-[3-[(3,4,5-trihydroxybenzoyl)amino]propyl]amino]butyl]benzamide.
| Compound Name | 3,4,5-trihydroxy-N-[4-[(3,4,5-trihydroxybenzoyl)-[3-[(3,4,5-trihydroxybenzoyl)amino]propyl]amino]butyl]benzamide |
|---|---|
| PubChem CID | 118731888 |
| Molecular Formula | C28H31N3O12 |
| Molecular Weight | 601.57 g/mol |
| Exact Mass | 601.19 |
| IUPAC Name | 3,4,5-trihydroxy-N-[4-[(3,4,5-trihydroxybenzoyl)-[3-[(3,4,5-trihydroxybenzoyl)amino]propyl]amino]butyl]benzamide |
| SMILES | O=C(NCCCCN(CCCNC(=O)c1cc(O)c(O)c(O)c1)C(=O)c1cc(O)c(O)c(O)c1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C28H31N3O12/c32-17-8-14(9-18(33)23(17)38)26(41)29-4-1-2-6-31(28(43)16-12-21(36)25(40)22(37)13-16)7-3-5-30-27(42)15-10-19(34)24(39)20(35)11-15/h8-13,32-40H,1-7H2,(H,29,41)(H,30,42) |
| InChIKey | GXEQDEYMUKRWKP-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 260.58 Ų |
| H-Bond Donors | 11 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 601.57 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 11 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|