C13H23Cl2N3O4 — CID 134157962
N-(5,6-diaminohexyl)-3,4,5-trihydroxybenzamide;dihydrochloride (PubChem CID 134157962) has the molecular formula C13H23Cl2N3O4 and a molecular weight of 356.25 g/mol. Its IUPAC name is N-(5,6-diaminohexyl)-3,4,5-trihydroxybenzamide;dihydrochloride.
| Compound Name | N-(5,6-diaminohexyl)-3,4,5-trihydroxybenzamide;dihydrochloride |
|---|---|
| PubChem CID | 134157962 |
| Molecular Formula | C13H23Cl2N3O4 |
| Molecular Weight | 356.25 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | N-(5,6-diaminohexyl)-3,4,5-trihydroxybenzamide;dihydrochloride |
| SMILES | Cl.Cl.NCC(N)CCCCNC(=O)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C13H21N3O4.2ClH/c14-7-9(15)3-1-2-4-16-13(20)8-5-10(17)12(19)11(18)6-8;;/h5-6,9,17-19H,1-4,7,14-15H2,(H,16,20);2*1H |
| InChIKey | DOUJAOZGHSPKHE-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 141.83 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.25 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|