C16H16N2O5S — CID 108540134
3,4,5-trihydroxy-N-[2-[(2-sulfanylbenzoyl)amino]ethyl]benzamide (PubChem CID 108540134) has the molecular formula C16H16N2O5S and a molecular weight of 348.38 g/mol. Its IUPAC name is 3,4,5-trihydroxy-N-[2-[(2-sulfanylbenzoyl)amino]ethyl]benzamide.
| Compound Name | 3,4,5-trihydroxy-N-[2-[(2-sulfanylbenzoyl)amino]ethyl]benzamide |
|---|---|
| PubChem CID | 108540134 |
| Molecular Formula | C16H16N2O5S |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 3,4,5-trihydroxy-N-[2-[(2-sulfanylbenzoyl)amino]ethyl]benzamide |
| SMILES | O=C(NCCNC(=O)c1ccccc1S)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C16H16N2O5S/c19-11-7-9(8-12(20)14(11)21)15(22)17-5-6-18-16(23)10-3-1-2-4-13(10)24/h1-4,7-8,19-21,24H,5-6H2,(H,17,22)(H,18,23) |
| InChIKey | PLKOICXMDBGFNS-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|