C14H14N2O6 — CID 108538997
N-[2-[(3,4,5-trihydroxybenzoyl)amino]ethyl]furan-2-carboxamide (PubChem CID 108538997) has the molecular formula C14H14N2O6 and a molecular weight of 306.27 g/mol. Its IUPAC name is N-[2-[(3,4,5-trihydroxybenzoyl)amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(3,4,5-trihydroxybenzoyl)amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 108538997 |
| Molecular Formula | C14H14N2O6 |
| Molecular Weight | 306.27 g/mol |
| Exact Mass | 306.09 |
| IUPAC Name | N-[2-[(3,4,5-trihydroxybenzoyl)amino]ethyl]furan-2-carboxamide |
| SMILES | O=C(NCCNC(=O)c1ccco1)c1cc(O)c(O)c(O)c1 |
| InChI | InChI=1S/C14H14N2O6/c17-9-6-8(7-10(18)12(9)19)13(20)15-3-4-16-14(21)11-2-1-5-22-11/h1-2,5-7,17-19H,3-4H2,(H,15,20)(H,16,21) |
| InChIKey | QLTSVDQXSMITPD-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 132.03 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.27 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|