C9H11ClN2O3 — CID 108571159
N-[2-[(2-chloroacetyl)amino]ethyl]furan-2-carboxamide (PubChem CID 108571159) has the molecular formula C9H11ClN2O3 and a molecular weight of 230.65 g/mol. Its IUPAC name is N-[2-[(2-chloroacetyl)amino]ethyl]furan-2-carboxamide.
| Compound Name | N-[2-[(2-chloroacetyl)amino]ethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 108571159 |
| Molecular Formula | C9H11ClN2O3 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | N-[2-[(2-chloroacetyl)amino]ethyl]furan-2-carboxamide |
| SMILES | O=C(CCl)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C9H11ClN2O3/c10-6-8(13)11-3-4-12-9(14)7-2-1-5-15-7/h1-2,5H,3-4,6H2,(H,11,13)(H,12,14) |
| InChIKey | XEVAWHNMNMNNMU-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|