C10H16ClN3O3 — CID 119278257
N-[2-(3-aminopropanoylamino)ethyl]furan-2-carboxamide;hydrochloride (PubChem CID 119278257) has the molecular formula C10H16ClN3O3 and a molecular weight of 261.71 g/mol. Its IUPAC name is N-[2-(3-aminopropanoylamino)ethyl]furan-2-carboxamide;hydrochloride.
| Compound Name | N-[2-(3-aminopropanoylamino)ethyl]furan-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119278257 |
| Molecular Formula | C10H16ClN3O3 |
| Molecular Weight | 261.71 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | N-[2-(3-aminopropanoylamino)ethyl]furan-2-carboxamide;hydrochloride |
| SMILES | Cl.NCCC(=O)NCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C10H15N3O3.ClH/c11-4-3-9(14)12-5-6-13-10(15)8-2-1-7-16-8;/h1-2,7H,3-6,11H2,(H,12,14)(H,13,15);1H |
| InChIKey | PLOATKIBNUUANR-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.71 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|