C8H9NO4 — CID 762504
3-(furan-2-carbonylamino)propanoic acid (PubChem CID 762504) has the molecular formula C8H9NO4 and a molecular weight of 183.16 g/mol. Its IUPAC name is 3-(furan-2-carbonylamino)propanoic acid.
| Compound Name | 3-(furan-2-carbonylamino)propanoic acid |
|---|---|
| PubChem CID | 762504 |
| Molecular Formula | C8H9NO4 |
| Molecular Weight | 183.16 g/mol |
| Exact Mass | 183.05 |
| IUPAC Name | 3-(furan-2-carbonylamino)propanoic acid |
| SMILES | O=C(O)CCNC(=O)c1ccco1 |
| InChI | InChI=1S/C8H9NO4/c10-7(11)3-4-9-8(12)6-2-1-5-13-6/h1-2,5H,3-4H2,(H,9,12)(H,10,11) |
| InChIKey | JYDIWQQDSQKTOK-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.16 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |