C11H14N2O6 — CID 107833526
(2S)-3-[3-(furan-2-carbonylamino)propanoylamino]-2-hydroxypropanoic acid (PubChem CID 107833526) has the molecular formula C11H14N2O6 and a molecular weight of 270.24 g/mol. Its IUPAC name is (2S)-3-[3-(furan-2-carbonylamino)propanoylamino]-2-hydroxypropanoic acid.
| Compound Name | (2S)-3-[3-(furan-2-carbonylamino)propanoylamino]-2-hydroxypropanoic acid |
|---|---|
| PubChem CID | 107833526 |
| Molecular Formula | C11H14N2O6 |
| Molecular Weight | 270.24 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | (2S)-3-[3-(furan-2-carbonylamino)propanoylamino]-2-hydroxypropanoic acid |
| SMILES | O=C(CCNC(=O)c1ccco1)NC[C@H](O)C(=O)O |
| InChI | InChI=1S/C11H14N2O6/c14-7(11(17)18)6-13-9(15)3-4-12-10(16)8-2-1-5-19-8/h1-2,5,7,14H,3-4,6H2,(H,12,16)(H,13,15)(H,17,18)/t7-/m0/s1 |
| InChIKey | LPMVXCXFKOFEEI-ZETCQYMHSA-N |
| XLogP | -1.04 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.24 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |