C19H22N2O5 — CID 119243012
2-[[3-(furan-2-carbonylamino)propanoylamino]methyl]-3-(3-methylphenyl)propanoic acid (PubChem CID 119243012) has the molecular formula C19H22N2O5 and a molecular weight of 358.39 g/mol. Its IUPAC name is 2-[[3-(furan-2-carbonylamino)propanoylamino]methyl]-3-(3-methylphenyl)propanoic acid.
| Compound Name | 2-[[3-(furan-2-carbonylamino)propanoylamino]methyl]-3-(3-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 119243012 |
| Molecular Formula | C19H22N2O5 |
| Molecular Weight | 358.39 g/mol |
| Exact Mass | 358.15 |
| IUPAC Name | 2-[[3-(furan-2-carbonylamino)propanoylamino]methyl]-3-(3-methylphenyl)propanoic acid |
| SMILES | Cc1cccc(CC(CNC(=O)CCNC(=O)c2ccco2)C(=O)O)c1 |
| InChI | InChI=1S/C19H22N2O5/c1-13-4-2-5-14(10-13)11-15(19(24)25)12-21-17(22)7-8-20-18(23)16-6-3-9-26-16/h2-6,9-10,15H,7-8,11-12H2,1H3,(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | ALJFFCNVSJFMQQ-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 108.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.39 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |