C20H22N2O4 — CID 119243253
2-[[(2-benzamidoacetyl)amino]methyl]-3-(3-methylphenyl)propanoic acid (PubChem CID 119243253) has the molecular formula C20H22N2O4 and a molecular weight of 354.41 g/mol. Its IUPAC name is 2-[[(2-benzamidoacetyl)amino]methyl]-3-(3-methylphenyl)propanoic acid.
| Compound Name | 2-[[(2-benzamidoacetyl)amino]methyl]-3-(3-methylphenyl)propanoic acid |
|---|---|
| PubChem CID | 119243253 |
| Molecular Formula | C20H22N2O4 |
| Molecular Weight | 354.41 g/mol |
| Exact Mass | 354.16 |
| IUPAC Name | 2-[[(2-benzamidoacetyl)amino]methyl]-3-(3-methylphenyl)propanoic acid |
| SMILES | Cc1cccc(CC(CNC(=O)CNC(=O)c2ccccc2)C(=O)O)c1 |
| InChI | InChI=1S/C20H22N2O4/c1-14-6-5-7-15(10-14)11-17(20(25)26)12-21-18(23)13-22-19(24)16-8-3-2-4-9-16/h2-10,17H,11-13H2,1H3,(H,21,23)(H,22,24)(H,25,26) |
| InChIKey | PQSYBQQZMAHNOI-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.41 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |