C14H16F3NO3S — CID 119242806
2-[(3-methylphenyl)methyl]-3-[[2-(trifluoromethylsulfanyl)acetyl]amino]propanoic acid (PubChem CID 119242806) has the molecular formula C14H16F3NO3S and a molecular weight of 335.35 g/mol. Its IUPAC name is 2-[(3-methylphenyl)methyl]-3-[[2-(trifluoromethylsulfanyl)acetyl]amino]propanoic acid.
| Compound Name | 2-[(3-methylphenyl)methyl]-3-[[2-(trifluoromethylsulfanyl)acetyl]amino]propanoic acid |
|---|---|
| PubChem CID | 119242806 |
| Molecular Formula | C14H16F3NO3S |
| Molecular Weight | 335.35 g/mol |
| Exact Mass | 335.08 |
| IUPAC Name | 2-[(3-methylphenyl)methyl]-3-[[2-(trifluoromethylsulfanyl)acetyl]amino]propanoic acid |
| SMILES | Cc1cccc(CC(CNC(=O)CSC(F)(F)F)C(=O)O)c1 |
| InChI | InChI=1S/C14H16F3NO3S/c1-9-3-2-4-10(5-9)6-11(13(20)21)7-18-12(19)8-22-14(15,16)17/h2-5,11H,6-8H2,1H3,(H,18,19)(H,20,21) |
| InChIKey | VGKWCVXYATXMIN-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.35 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |