C13H20N2O5 — CID 103876816
N-[3-[(3-hydroxy-4-methoxybutyl)amino]-3-oxopropyl]furan-2-carboxamide (PubChem CID 103876816) has the molecular formula C13H20N2O5 and a molecular weight of 284.31 g/mol. Its IUPAC name is N-[3-[(3-hydroxy-4-methoxybutyl)amino]-3-oxopropyl]furan-2-carboxamide.
| Compound Name | N-[3-[(3-hydroxy-4-methoxybutyl)amino]-3-oxopropyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 103876816 |
| Molecular Formula | C13H20N2O5 |
| Molecular Weight | 284.31 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | N-[3-[(3-hydroxy-4-methoxybutyl)amino]-3-oxopropyl]furan-2-carboxamide |
| SMILES | COCC(O)CCNC(=O)CCNC(=O)c1ccco1 |
| InChI | InChI=1S/C13H20N2O5/c1-19-9-10(16)4-6-14-12(17)5-7-15-13(18)11-3-2-8-20-11/h2-3,8,10,16H,4-7,9H2,1H3,(H,14,17)(H,15,18) |
| InChIKey | FJGXFHOFVHRBND-UHFFFAOYSA-N |
| XLogP | -0.09 |
| TPSA | 100.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.31 |
| LogP ≤ 5 | -0.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |