C13H18N2O6 — CID 62479824
2-[3-(furan-2-carbonylamino)propanoylamino]-4-methoxybutanoic acid (PubChem CID 62479824) has the molecular formula C13H18N2O6 and a molecular weight of 298.29 g/mol. Its IUPAC name is 2-[3-(furan-2-carbonylamino)propanoylamino]-4-methoxybutanoic acid.
| Compound Name | 2-[3-(furan-2-carbonylamino)propanoylamino]-4-methoxybutanoic acid |
|---|---|
| PubChem CID | 62479824 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 2-[3-(furan-2-carbonylamino)propanoylamino]-4-methoxybutanoic acid |
| SMILES | COCCC(NC(=O)CCNC(=O)c1ccco1)C(=O)O |
| InChI | InChI=1S/C13H18N2O6/c1-20-8-5-9(13(18)19)15-11(16)4-6-14-12(17)10-3-2-7-21-10/h2-3,7,9H,4-6,8H2,1H3,(H,14,17)(H,15,16)(H,18,19) |
| InChIKey | PQGVGDUZGGHYNW-UHFFFAOYSA-N |
| XLogP | 0.01 |
| TPSA | 117.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |