C10H15NO3 — CID 60769533
N-(4-methoxybutyl)furan-2-carboxamide (PubChem CID 60769533) has the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. Its IUPAC name is N-(4-methoxybutyl)furan-2-carboxamide.
| Compound Name | N-(4-methoxybutyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 60769533 |
| Molecular Formula | C10H15NO3 |
| Molecular Weight | 197.23 g/mol |
| Exact Mass | 197.11 |
| IUPAC Name | N-(4-methoxybutyl)furan-2-carboxamide |
| SMILES | COCCCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C10H15NO3/c1-13-7-3-2-6-11-10(12)9-5-4-8-14-9/h4-5,8H,2-3,6-7H2,1H3,(H,11,12) |
| InChIKey | KKVIWTQRIGNDDC-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.23 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|