C9H12N2O3 — CID 110461151
N-(3-formamidopropyl)furan-2-carboxamide (PubChem CID 110461151) has the molecular formula C9H12N2O3 and a molecular weight of 196.21 g/mol. Its IUPAC name is N-(3-formamidopropyl)furan-2-carboxamide.
| Compound Name | N-(3-formamidopropyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 110461151 |
| Molecular Formula | C9H12N2O3 |
| Molecular Weight | 196.21 g/mol |
| Exact Mass | 196.08 |
| IUPAC Name | N-(3-formamidopropyl)furan-2-carboxamide |
| SMILES | O=CNCCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C9H12N2O3/c12-7-10-4-2-5-11-9(13)8-3-1-6-14-8/h1,3,6-7H,2,4-5H2,(H,10,12)(H,11,13) |
| InChIKey | HHTQBGIJIJIWCS-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.21 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|