C12H18N2O5 — CID 65312462
N-[4-(1,3-dihydroxypropan-2-ylamino)-4-oxobutyl]furan-2-carboxamide (PubChem CID 65312462) has the molecular formula C12H18N2O5 and a molecular weight of 270.28 g/mol. Its IUPAC name is N-[4-(1,3-dihydroxypropan-2-ylamino)-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-(1,3-dihydroxypropan-2-ylamino)-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 65312462 |
| Molecular Formula | C12H18N2O5 |
| Molecular Weight | 270.28 g/mol |
| Exact Mass | 270.12 |
| IUPAC Name | N-[4-(1,3-dihydroxypropan-2-ylamino)-4-oxobutyl]furan-2-carboxamide |
| SMILES | O=C(CCCNC(=O)c1ccco1)NC(CO)CO |
| InChI | InChI=1S/C12H18N2O5/c15-7-9(8-16)14-11(17)4-1-5-13-12(18)10-3-2-6-19-10/h2-3,6,9,15-16H,1,4-5,7-8H2,(H,13,18)(H,14,17) |
| InChIKey | NFLXTWXFSUSFJI-UHFFFAOYSA-N |
| XLogP | -0.74 |
| TPSA | 111.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.28 |
| LogP ≤ 5 | -0.74 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|