C12H17N3O5 — CID 106164627
N-[4-[(3-amino-2-hydroxy-3-oxopropyl)amino]-4-oxobutyl]furan-2-carboxamide (PubChem CID 106164627) has the molecular formula C12H17N3O5 and a molecular weight of 283.28 g/mol. Its IUPAC name is N-[4-[(3-amino-2-hydroxy-3-oxopropyl)amino]-4-oxobutyl]furan-2-carboxamide.
| Compound Name | N-[4-[(3-amino-2-hydroxy-3-oxopropyl)amino]-4-oxobutyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 106164627 |
| Molecular Formula | C12H17N3O5 |
| Molecular Weight | 283.28 g/mol |
| Exact Mass | 283.12 |
| IUPAC Name | N-[4-[(3-amino-2-hydroxy-3-oxopropyl)amino]-4-oxobutyl]furan-2-carboxamide |
| SMILES | NC(=O)C(O)CNC(=O)CCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C12H17N3O5/c13-11(18)8(16)7-15-10(17)4-1-5-14-12(19)9-3-2-6-20-9/h2-3,6,8,16H,1,4-5,7H2,(H2,13,18)(H,14,19)(H,15,17) |
| InChIKey | NTHAALFHTREWMP-UHFFFAOYSA-N |
| XLogP | -1.25 |
| TPSA | 134.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.28 |
| LogP ≤ 5 | -1.25 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|