C13H18N2O6 — CID 66172562
3-[4-(furan-2-carbonylamino)butanoylamino]-2-hydroxy-2-methylpropanoic acid (PubChem CID 66172562) has the molecular formula C13H18N2O6 and a molecular weight of 298.29 g/mol. Its IUPAC name is 3-[4-(furan-2-carbonylamino)butanoylamino]-2-hydroxy-2-methylpropanoic acid.
| Compound Name | 3-[4-(furan-2-carbonylamino)butanoylamino]-2-hydroxy-2-methylpropanoic acid |
|---|---|
| PubChem CID | 66172562 |
| Molecular Formula | C13H18N2O6 |
| Molecular Weight | 298.29 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 3-[4-(furan-2-carbonylamino)butanoylamino]-2-hydroxy-2-methylpropanoic acid |
| SMILES | CC(O)(CNC(=O)CCCNC(=O)c1ccco1)C(=O)O |
| InChI | InChI=1S/C13H18N2O6/c1-13(20,12(18)19)8-15-10(16)5-2-6-14-11(17)9-4-3-7-21-9/h3-4,7,20H,2,5-6,8H2,1H3,(H,14,17)(H,15,16)(H,18,19) |
| InChIKey | CPOXIFVYSDAJDW-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 128.87 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.29 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|