C11H17NO3S — CID 71875126
N-[2-(2-hydroxy-2-methylpropyl)sulfanylethyl]furan-2-carboxamide (PubChem CID 71875126) has the molecular formula C11H17NO3S and a molecular weight of 243.33 g/mol. Its IUPAC name is N-[2-(2-hydroxy-2-methylpropyl)sulfanylethyl]furan-2-carboxamide.
| Compound Name | N-[2-(2-hydroxy-2-methylpropyl)sulfanylethyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 71875126 |
| Molecular Formula | C11H17NO3S |
| Molecular Weight | 243.33 g/mol |
| Exact Mass | 243.09 |
| IUPAC Name | N-[2-(2-hydroxy-2-methylpropyl)sulfanylethyl]furan-2-carboxamide |
| SMILES | CC(C)(O)CSCCNC(=O)c1ccco1 |
| InChI | InChI=1S/C11H17NO3S/c1-11(2,14)8-16-7-5-12-10(13)9-4-3-6-15-9/h3-4,6,14H,5,7-8H2,1-2H3,(H,12,13) |
| InChIKey | KIPLVQGCMIDXFA-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.33 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|