C12H19NO3 — CID 95740792
N-[(3R)-3-hydroxy-4,4-dimethylpentyl]furan-2-carboxamide (PubChem CID 95740792) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is N-[(3R)-3-hydroxy-4,4-dimethylpentyl]furan-2-carboxamide.
| Compound Name | N-[(3R)-3-hydroxy-4,4-dimethylpentyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 95740792 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | N-[(3R)-3-hydroxy-4,4-dimethylpentyl]furan-2-carboxamide |
| SMILES | CC(C)(C)[C@H](O)CCNC(=O)c1ccco1 |
| InChI | InChI=1S/C12H19NO3/c1-12(2,3)10(14)6-7-13-11(15)9-5-4-8-16-9/h4-5,8,10,14H,6-7H2,1-3H3,(H,13,15)/t10-/m1/s1 |
| InChIKey | CPWVRIRGOZDTAA-SNVBAGLBSA-N |
| XLogP | 1.81 |
| TPSA | 62.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |